CAS 2377609-68-0 appears in our catalog under these names: 6-Cyano-3-methylbenzodiazole-4-boronic acid, 96%, 6-Cyano-3-methylbenzodiazole-4-boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(6-cyano-3-methylbenzimidazol-4-yl)boronic acid (CAS 2377609-68-0) is a chemical compound with the molecular formula C9H8BN3O2 and a molecular weight of 200.99 g/mol. IUPAC name: (6-cyano-3-methylbenzimidazol-4-yl)boronic acid. InChIKey: BLMPCVGSSOXHAQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BN3O2 |
|---|---|
| Molecular weight | 200.99 g/mol |
| IUPAC name | (6-cyano-3-methylbenzimidazol-4-yl)boronic acid |
| InChIKey | BLMPCVGSSOXHAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=C1N(C=N2)C)C#N)(O)O |
Computed by PubChem (NCBI)