CAS 2377609-81-7 appears in our catalog under these names: 1-Boc-6-(methoxycarbonyl)indole-3-boronic Acid Pinacol Ester, 98%, 98%, 1-(tert-butyl) 6-Methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1,6-dicarboxylate, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
1-O-tert-butyl 6-O-methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1,6-dicarboxylate (CAS 2377609-81-7) is a chemical compound with the molecular formula C21H28BNO6 and a molecular weight of 401.3 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1,6-dicarboxylate. InChIKey: JWWJLMSXACHNRH-UHFFFAOYSA-N.
| Molecular formula | C21H28BNO6 |
|---|---|
| Molecular weight | 401.3 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1,6-dicarboxylate |
| InChIKey | JWWJLMSXACHNRH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC(=C3)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)