Products 2377609-85-1

CAS 2377609-85-1 is the registry number for 5-Cyano-2-fluoropyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

(5-cyano-2-fluoro-3-pyridinyl)boronic acid (CAS 2377609-85-1) is a chemical compound with the molecular formula C6H4BFN2O2 and a molecular weight of 165.92 g/mol. IUPAC name: (5-cyano-2-fluoro-3-pyridinyl)boronic acid. InChIKey: VMJBZRFMORBFIR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BFN2O2
Molecular weight165.92 g/mol
IUPAC name(5-cyano-2-fluoro-3-pyridinyl)boronic acid
InChIKeyVMJBZRFMORBFIR-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1F)C#N)(O)O

Computed by PubChem (NCBI)