CAS 2377609-93-1 is the registry number for 4-Boc-amino-3,5-dichlorophenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[3,5-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2377609-93-1) is a chemical compound with the molecular formula C11H14BCl2NO4 and a molecular weight of 305.9 g/mol. IUPAC name: [3,5-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: LFCFAVKISHNFNI-UHFFFAOYSA-N.
| Molecular formula | C11H14BCl2NO4 |
|---|---|
| Molecular weight | 305.9 g/mol |
| IUPAC name | [3,5-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | LFCFAVKISHNFNI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)NC(=O)OC(C)(C)C)Cl)(O)O |
Computed by PubChem (NCBI)