CAS 2377610-01-8 appears in our catalog under these names: 2-Fluorophenyl-1,3-diboronic acid, 98%, (2-Fluoro-1,3-phenylene)diboronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3-borono-2-fluorophenyl)boronic acid (CAS 2377610-01-8) is a chemical compound with the molecular formula C6H7B2FO4 and a molecular weight of 183.74 g/mol. IUPAC name: (3-borono-2-fluorophenyl)boronic acid. InChIKey: AIVHMMKXCCYYTA-UHFFFAOYSA-N.
| Molecular formula | C6H7B2FO4 |
|---|---|
| Molecular weight | 183.74 g/mol |
| IUPAC name | (3-borono-2-fluorophenyl)boronic acid |
| InChIKey | AIVHMMKXCCYYTA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)B(O)O)F)(O)O |
Computed by PubChem (NCBI)