CAS 2377610-03-0 is the registry number for 1-(Dimethylsulfamoyl)pyrrole-2-boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
[1-(dimethylsulfamoyl)pyrrol-2-yl]boronic acid (CAS 2377610-03-0) is a chemical compound with the molecular formula C6H11BN2O4S and a molecular weight of 218.04 g/mol. IUPAC name: [1-(dimethylsulfamoyl)pyrrol-2-yl]boronic acid. InChIKey: GLSNODSWDWHGNP-UHFFFAOYSA-N.
| Molecular formula | C6H11BN2O4S |
|---|---|
| Molecular weight | 218.04 g/mol |
| IUPAC name | [1-(dimethylsulfamoyl)pyrrol-2-yl]boronic acid |
| InChIKey | GLSNODSWDWHGNP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CN1S(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)