CAS 2377610-13-2 is the registry number for 5-Bromo-2,3-difluoro-4-formylphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-bromo-2,3-difluoro-4-formylphenyl)boronic acid (CAS 2377610-13-2) is a chemical compound with the molecular formula C7H4BBrF2O3 and a molecular weight of 264.82 g/mol. IUPAC name: (5-bromo-2,3-difluoro-4-formylphenyl)boronic acid. InChIKey: VJCJGFVJKNHBBX-UHFFFAOYSA-N.
| Molecular formula | C7H4BBrF2O3 |
|---|---|
| Molecular weight | 264.82 g/mol |
| IUPAC name | (5-bromo-2,3-difluoro-4-formylphenyl)boronic acid |
| InChIKey | VJCJGFVJKNHBBX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)C=O)Br)(O)O |
Computed by PubChem (NCBI)