CAS 2377610-39-2 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(2-(methylthio)-5-nitrophenyl)-1,3,2-dioxaborolane, 98%, 2-Methylthio-5-nitrophenylboronic acid pinacol ester, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4,4,5,5-tetramethyl-2-(2-methylsulfanyl-5-nitrophenyl)-1,3,2-dioxaborolane (CAS 2377610-39-2) is a chemical compound with the molecular formula C13H18BNO4S and a molecular weight of 295.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylsulfanyl-5-nitrophenyl)-1,3,2-dioxaborolane. InChIKey: MOPLSPLZFABVSH-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO4S |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylsulfanyl-5-nitrophenyl)-1,3,2-dioxaborolane |
| InChIKey | MOPLSPLZFABVSH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])SC |
Computed by PubChem (NCBI)