CAS 2377610-52-9 is the registry number for 4-Chloro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride (CAS 2377610-52-9) is a chemical compound with the molecular formula C12H18BCl2NO2 and a molecular weight of 290.0 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride. InChIKey: NVRFZDKTVGTGQA-UHFFFAOYSA-N.
| Molecular formula | C12H18BCl2NO2 |
|---|---|
| Molecular weight | 290.0 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;hydrochloride |
| InChIKey | NVRFZDKTVGTGQA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)N)Cl.Cl |
Computed by PubChem (NCBI)