CAS 2377610-53-0 is the registry number for Methyl 2-(tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzoate (CAS 2377610-53-0) is a chemical compound with the molecular formula C15H18BF3O5 and a molecular weight of 346.11 g/mol. IUPAC name: methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzoate. InChIKey: ZLRXOXQZCJJTPZ-UHFFFAOYSA-N.
| Molecular formula | C15H18BF3O5 |
|---|---|
| Molecular weight | 346.11 g/mol |
| IUPAC name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)benzoate |
| InChIKey | ZLRXOXQZCJJTPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)