CAS 2377610-92-7 is the registry number for 3-(N-Butylaminomethyl)-4-fluorophenylboronic acid pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butan-1-amine (CAS 2377610-92-7) is a chemical compound with the molecular formula C17H27BFNO2 and a molecular weight of 307.2 g/mol. IUPAC name: N-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butan-1-amine. InChIKey: VNOLRTYVYWPWRW-UHFFFAOYSA-N.
| Molecular formula | C17H27BFNO2 |
|---|---|
| Molecular weight | 307.2 g/mol |
| IUPAC name | N-[[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butan-1-amine |
| InChIKey | VNOLRTYVYWPWRW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)CNCCCC |
Computed by PubChem (NCBI)