CAS 2377610-93-8 appears in our catalog under these names: 2-Fluoro-3-(trifluoroacetamido)phenylboronic acid, 98%, (2-Fluoro-3-(2,2,2-trifluoroacetamido)phenyl)boronic acid, 97%, 2-Fluoro-3-(trifluoroacetamido)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 2g.
[2-fluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid (CAS 2377610-93-8) is a chemical compound with the molecular formula C8H6BF4NO3 and a molecular weight of 250.94 g/mol. IUPAC name: [2-fluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid. InChIKey: CBALCADDVWOFRO-UHFFFAOYSA-N.
| Molecular formula | C8H6BF4NO3 |
|---|---|
| Molecular weight | 250.94 g/mol |
| IUPAC name | [2-fluoro-3-[(2,2,2-trifluoroacetyl)amino]phenyl]boronic acid |
| InChIKey | CBALCADDVWOFRO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)NC(=O)C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)