Products 2377611-26-0

CAS 2377611-26-0 is the registry number for 4-(1-Cyano-1-methylethyl)-3-fluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[4-(2-cyanopropan-2-yl)-3-fluorophenyl]boronic acid (CAS 2377611-26-0) is a chemical compound with the molecular formula C10H11BFNO2 and a molecular weight of 207.01 g/mol. IUPAC name: [4-(2-cyanopropan-2-yl)-3-fluorophenyl]boronic acid. InChIKey: DKVAOBRSYFKRFR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BFNO2
Molecular weight207.01 g/mol
IUPAC name[4-(2-cyanopropan-2-yl)-3-fluorophenyl]boronic acid
InChIKeyDKVAOBRSYFKRFR-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)C(C)(C)C#N)F)(O)O

Computed by PubChem (NCBI)