Products 2377611-32-8

CAS 2377611-32-8 is the registry number for 2-(3-Chlorophenoxy)pyridine-5-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[6-(3-chlorophenoxy)-3-pyridinyl]boronic acid (CAS 2377611-32-8) is a chemical compound with the molecular formula C11H9BClNO3 and a molecular weight of 249.46 g/mol. IUPAC name: [6-(3-chlorophenoxy)-3-pyridinyl]boronic acid. InChIKey: DVSHNGBOFNHZMW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BClNO3
Molecular weight249.46 g/mol
IUPAC name[6-(3-chlorophenoxy)-3-pyridinyl]boronic acid
InChIKeyDVSHNGBOFNHZMW-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)OC2=CC(=CC=C2)Cl)(O)O

Computed by PubChem (NCBI)