Products 2377611-39-5

CAS 2377611-39-5 is the registry number for 1-Butyl-3-(trifluoromethyl)pyrazole-5-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[1-butyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid (CAS 2377611-39-5) is a chemical compound with the molecular formula C8H12BF3N2O2 and a molecular weight of 236.00 g/mol. IUPAC name: [1-butyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid. InChIKey: QWFNIPKLRPHQLC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12BF3N2O2
Molecular weight236.00 g/mol
IUPAC name[1-butyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid
InChIKeyQWFNIPKLRPHQLC-UHFFFAOYSA-N
SMILESB(C1=CC(=NN1CCCC)C(F)(F)F)(O)O

Computed by PubChem (NCBI)