CAS 2377611-43-1 appears in our catalog under these names: 4-Chloro-3-(dihydroxyboranyl)-5-nitrobenzoic acid, 96%, 4-CHloro-3-(dihydroxyboranyl)-5-nitrobenzoic acid, 95%, 4-Chloro-3-(dihydroxyboranyl)-5-nitrobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg.
3-borono-4-chloro-5-nitrobenzoic acid (CAS 2377611-43-1) is a chemical compound with the molecular formula C7H5BClNO6 and a molecular weight of 245.38 g/mol. IUPAC name: 3-borono-4-chloro-5-nitrobenzoic acid. InChIKey: HJYGDFGFKSCLRJ-UHFFFAOYSA-N.
| Molecular formula | C7H5BClNO6 |
|---|---|
| Molecular weight | 245.38 g/mol |
| IUPAC name | 3-borono-4-chloro-5-nitrobenzoic acid |
| InChIKey | HJYGDFGFKSCLRJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)[N+](=O)[O-])C(=O)O)(O)O |
Computed by PubChem (NCBI)