CAS 2377611-44-2 appears in our catalog under these names: 4-Carboxy-3,5-difluoro-2-nitrophenylboronic acid, 95%, 4-Borono-2,6-difluoro-3-nitrobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
4-borono-2,6-difluoro-3-nitrobenzoic acid (CAS 2377611-44-2) is a chemical compound with the molecular formula C7H4BF2NO6 and a molecular weight of 246.92 g/mol. IUPAC name: 4-borono-2,6-difluoro-3-nitrobenzoic acid. InChIKey: HJNATQFOBCZWAN-UHFFFAOYSA-N.
| Molecular formula | C7H4BF2NO6 |
|---|---|
| Molecular weight | 246.92 g/mol |
| IUPAC name | 4-borono-2,6-difluoro-3-nitrobenzoic acid |
| InChIKey | HJNATQFOBCZWAN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1[N+](=O)[O-])F)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)