CAS 2377611-63-5 is the registry number for 2-Bromo-6-fluoro-3-nitrophenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(2-bromo-6-fluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377611-63-5) is a chemical compound with the molecular formula C12H14BBrFNO4 and a molecular weight of 345.96 g/mol. IUPAC name: 2-(2-bromo-6-fluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BIYJDUWLJIBHGB-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrFNO4 |
|---|---|
| Molecular weight | 345.96 g/mol |
| IUPAC name | 2-(2-bromo-6-fluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BIYJDUWLJIBHGB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)