CAS 2377611-75-9 appears in our catalog under these names: 2-(BOC-Amino)-5-(trifluoromethyl)phenylboronic acid, 96%, (2-((tert-Butoxycarbonyl)amino)-5-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)phenyl]boronic acid (CAS 2377611-75-9) is a chemical compound with the molecular formula C12H15BF3NO4 and a molecular weight of 305.06 g/mol. IUPAC name: [2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: LWKJXRQCCYASCY-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO4 |
|---|---|
| Molecular weight | 305.06 g/mol |
| IUPAC name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LWKJXRQCCYASCY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)