CAS 2377611-86-2 is the registry number for 2-(Bromomethyl)-3,4,5-trichlorophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
2-[2-(bromomethyl)-3,4,5-trichlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377611-86-2) is a chemical compound with the molecular formula C13H15BBrCl3O2 and a molecular weight of 400.3 g/mol. IUPAC name: 2-[2-(bromomethyl)-3,4,5-trichlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HWXJQGHPTWRJAK-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrCl3O2 |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-3,4,5-trichlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HWXJQGHPTWRJAK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2CBr)Cl)Cl)Cl |
Computed by PubChem (NCBI)