CAS 2377611-92-0 appears in our catalog under these names: 2-Chloro-5-methoxycarbonyl-3-nitrophenylboronic acid pinacol ester, 98%, Methyl 4-chloro-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 4-chloro-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2377611-92-0) is a chemical compound with the molecular formula C14H17BClNO6 and a molecular weight of 341.55 g/mol. IUPAC name: methyl 4-chloro-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: DGQOYQTVWLDJKJ-UHFFFAOYSA-N.
| Molecular formula | C14H17BClNO6 |
|---|---|
| Molecular weight | 341.55 g/mol |
| IUPAC name | methyl 4-chloro-3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | DGQOYQTVWLDJKJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2Cl)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)