CAS 2377723-88-9 appears in our catalog under these names: Metsulfuron-methyl-d3, >95% (HPLC), Metsulfuron-methyl D3 (triazine methoxy D3). Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 25mg, 50mg, 5mg, 10mg.
Methyl 2-[[4-methyl-6-(trideuteriomethoxy)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoate (CAS 2377723-88-9) is a chemical compound with the molecular formula C14H15N5O6S and a molecular weight of 384.38 g/mol. IUPAC name: methyl 2-[[4-methyl-6-(trideuteriomethoxy)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoate. InChIKey: RSMUVYRMZCOLBH-HPRDVNIFSA-N.
| Molecular formula | C14H15N5O6S |
|---|---|
| Molecular weight | 384.38 g/mol |
| IUPAC name | methyl 2-[[4-methyl-6-(trideuteriomethoxy)-1,3,5-triazin-2-yl]carbamoylsulfamoyl]benzoate |
| InChIKey | RSMUVYRMZCOLBH-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC(=NC(=N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC)C |
Computed by PubChem (NCBI)