CAS 2377769-17-8 is the registry number for rel-tert-Butyl (3aR,7aS)-tetrahydro-1H-3a,7a-(methanoiminomethano)isoindole-2(3H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S,6R)-8,11-diazatricyclo[4.3.3.01,6]dodecane-8-carboxylate (CAS 2377769-17-8) is a chemical compound with the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. IUPAC name: tert-butyl (1S,6R)-8,11-diazatricyclo[4.3.3.01,6]dodecane-8-carboxylate. InChIKey: QNQLHHBLCMGKQG-GASCZTMLSA-N.
| Molecular formula | C15H26N2O2 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | tert-butyl (1S,6R)-8,11-diazatricyclo[4.3.3.01,6]dodecane-8-carboxylate |
| InChIKey | QNQLHHBLCMGKQG-GASCZTMLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@]23CCCC[C@@]2(C1)CNC3 |
Computed by PubChem (NCBI)