Products 372963-43-4
CAS 372963-43-4 is the registry number for tert-Butyl N-(3-Aminoadamant-1-yl)carbamate. Offered by: TRC. Available pack sizes: 1g.
Tert-butyl N-(3-amino-1-adamantyl)carbamate (CAS 372963-43-4) is a chemical compound with the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. IUPAC name: tert-butyl N-(3-amino-1-adamantyl)carbamate. InChIKey: ORXKBGARESRNIZ-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O2 |
|---|---|
| Molecular weight | 266.38 g/mol |
| IUPAC name | tert-butyl N-(3-amino-1-adamantyl)carbamate |
| InChIKey | ORXKBGARESRNIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC(C1)CC(C3)(C2)N |
Computed by PubChem (NCBI)