CAS 2377908-02-4 is the registry number for 1-(2,5-Dichloro-3,4-bis((4-methoxybenzyl)oxy)phenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2,5-dichloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]ethanone (CAS 2377908-02-4) is a chemical compound with the molecular formula C24H22Cl2O5 and a molecular weight of 461.3 g/mol. IUPAC name: 1-[2,5-dichloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]ethanone. InChIKey: CRUXGAHJMAEXAE-UHFFFAOYSA-N.
| Molecular formula | C24H22Cl2O5 |
|---|---|
| Molecular weight | 461.3 g/mol |
| IUPAC name | 1-[2,5-dichloro-3,4-bis[(4-methoxyphenyl)methoxy]phenyl]ethanone |
| InChIKey | CRUXGAHJMAEXAE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1Cl)OCC2=CC=C(C=C2)OC)OCC3=CC=C(C=C3)OC)Cl |
Computed by PubChem (NCBI)