CAS 2377912-28-0 appears in our catalog under these names: 2-Fluoro-5-((3-oxoisobenzofuran-1(3h)-ylidene)methyl)benzonitrile, 95%, Olaparib Impurity N, Olaparib Impurity 92, Olaparib Impurity 48. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 1g, 5g, on request.
2-fluoro-5-[(E)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzonitrile (CAS 2377912-28-0) is a chemical compound with the molecular formula C16H8FNO2 and a molecular weight of 265.24 g/mol. IUPAC name: 2-fluoro-5-[(E)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzonitrile. InChIKey: MMPHWTMMVPBHRZ-OVCLIPMQSA-N.
| Molecular formula | C16H8FNO2 |
|---|---|
| Molecular weight | 265.24 g/mol |
| IUPAC name | 2-fluoro-5-[(E)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzonitrile |
| InChIKey | MMPHWTMMVPBHRZ-OVCLIPMQSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C\C3=CC(=C(C=C3)F)C#N)/OC2=O |
Computed by PubChem (NCBI)