CAS 2378-08-7 is the registry number for Fluoropentachloroacetone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1,1,1,3,3-pentachloro-3-fluoropropan-2-one (CAS 2378-08-7) is a chemical compound with the molecular formula C3Cl5FO and a molecular weight of 248.3 g/mol. IUPAC name: 1,1,1,3,3-pentachloro-3-fluoropropan-2-one. InChIKey: VODZXUJSDKOZEW-UHFFFAOYSA-N.
| Molecular formula | C3Cl5FO |
|---|---|
| Molecular weight | 248.3 g/mol |
| IUPAC name | 1,1,1,3,3-pentachloro-3-fluoropropan-2-one |
| InChIKey | VODZXUJSDKOZEW-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)