CAS 2378-86-1 is the registry number for (4-Methylbenzyl)triphenylphosphonium bromide, 98+% . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 5g , 25g .
(4-methylphenyl)methyl-triphenylphosphanium bromide (CAS 2378-86-1) is a chemical compound with the molecular formula C26H24BrP and a molecular weight of 447.3 g/mol. IUPAC name: (4-methylphenyl)methyl-triphenylphosphanium bromide. InChIKey: CEEKCHGNKYVTTM-UHFFFAOYSA-M.
| Molecular formula | C26H24BrP |
|---|---|
| Molecular weight | 447.3 g/mol |
| IUPAC name | (4-methylphenyl)methyl-triphenylphosphanium bromide |
| InChIKey | CEEKCHGNKYVTTM-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)