CAS 2378259-33-5 appears in our catalog under these names: (4-Chloro-2-hydroxy-5-(1-methylcyclopropyl)phenyl)glycine, 95%, (4-Chloro-2-hydroxy-5-(1-methylcyclopropyl)phenyl)glycine, 95%, 95%, 2-((4-chloro-2-hydroxy-5-(1-methylcyclopropyl)phenyl)amino)acetic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg.
2-[4-chloro-2-hydroxy-5-(1-methylcyclopropyl)anilino]acetic acid (CAS 2378259-33-5) is a chemical compound with the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. IUPAC name: 2-[4-chloro-2-hydroxy-5-(1-methylcyclopropyl)anilino]acetic acid. InChIKey: LHDUSKXHKXXCIP-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 2-[4-chloro-2-hydroxy-5-(1-methylcyclopropyl)anilino]acetic acid |
| InChIKey | LHDUSKXHKXXCIP-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C2=CC(=C(C=C2Cl)O)NCC(=O)O |
Computed by PubChem (NCBI)