Products 2378490-00-5
CAS 2378490-00-5 is the registry number for rac-(1R,2S,5S)-5-(Propan-2-yl)bicyclo(3.1.0)hexan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(1R,2S,5S)-5-propan-2-ylbicyclo[3.1.0]hexan-2-amine;hydrochloride (CAS 2378490-00-5) is a chemical compound with the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. IUPAC name: (1R,2S,5S)-5-propan-2-ylbicyclo[3.1.0]hexan-2-amine;hydrochloride. InChIKey: MPVNPOJKXCMCEM-YWUTZLAHSA-N.
| Molecular formula | C9H18ClN |
|---|---|
| Molecular weight | 175.70 g/mol |
| IUPAC name | (1R,2S,5S)-5-propan-2-ylbicyclo[3.1.0]hexan-2-amine;hydrochloride |
| InChIKey | MPVNPOJKXCMCEM-YWUTZLAHSA-N |
| SMILES | CC(C)[C@@]12CC[C@@H]([C@@H]1C2)N.Cl |
Computed by PubChem (NCBI)