CAS 2378490-74-3 is the registry number for rac-(2R,5S)-5-Cyclopentyl-2-methylpiperidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,5S)-5-cyclopentyl-2-methylpiperidine (CAS 2378490-74-3) is a chemical compound with the molecular formula C11H21N and a molecular weight of 167.29 g/mol. IUPAC name: (2R,5S)-5-cyclopentyl-2-methylpiperidine. InChIKey: HGPFSZCYHPLMEF-MWLCHTKSSA-N.
| Molecular formula | C11H21N |
|---|---|
| Molecular weight | 167.29 g/mol |
| IUPAC name | (2R,5S)-5-cyclopentyl-2-methylpiperidine |
| InChIKey | HGPFSZCYHPLMEF-MWLCHTKSSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1)C2CCCC2 |
Computed by PubChem (NCBI)