CAS 2378501-04-1 is the registry number for (2-Aminoethyl)((3,4-dichlorophenyl)methyl)ethylamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N'-[(3,4-dichlorophenyl)methyl]-N'-ethylethane-1,2-diamine;dihydrochloride (CAS 2378501-04-1) is a chemical compound with the molecular formula C11H18Cl4N2 and a molecular weight of 320.1 g/mol. IUPAC name: N'-[(3,4-dichlorophenyl)methyl]-N'-ethylethane-1,2-diamine;dihydrochloride. InChIKey: TVRBLBKMBIFKJH-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl4N2 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | N'-[(3,4-dichlorophenyl)methyl]-N'-ethylethane-1,2-diamine;dihydrochloride |
| InChIKey | TVRBLBKMBIFKJH-UHFFFAOYSA-N |
| SMILES | CCN(CCN)CC1=CC(=C(C=C1)Cl)Cl.Cl.Cl |
Computed by PubChem (NCBI)