Products 2378501-07-4
CAS 2378501-07-4 is the registry number for 3-(2-Aminoethyl)-1H,2H,3H-imidazo(4,5-b)pyridin-2-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2-aminoethyl)-1H-imidazo[4,5-b]pyridin-2-one;dihydrochloride (CAS 2378501-07-4) is a chemical compound with the molecular formula C8H12Cl2N4O and a molecular weight of 251.11 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-imidazo[4,5-b]pyridin-2-one;dihydrochloride. InChIKey: AKSYJKSJYTYVJG-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4O |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-imidazo[4,5-b]pyridin-2-one;dihydrochloride |
| InChIKey | AKSYJKSJYTYVJG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N(C(=O)N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)