CAS 2378502-20-4 is the registry number for 1-{((3-Fluoropyridin-2-yl)oxy)methyl}cyclopentan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(3-fluoro-2-pyridinyl)oxymethyl]cyclopentan-1-amine;dihydrochloride (CAS 2378502-20-4) is a chemical compound with the molecular formula C11H17Cl2FN2O and a molecular weight of 283.17 g/mol. IUPAC name: 1-[(3-fluoro-2-pyridinyl)oxymethyl]cyclopentan-1-amine;dihydrochloride. InChIKey: VCDBWMQJJYAFFV-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2FN2O |
|---|---|
| Molecular weight | 283.17 g/mol |
| IUPAC name | 1-[(3-fluoro-2-pyridinyl)oxymethyl]cyclopentan-1-amine;dihydrochloride |
| InChIKey | VCDBWMQJJYAFFV-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(COC2=C(C=CC=N2)F)N.Cl.Cl |
Computed by PubChem (NCBI)