CAS 2378503-07-0 is the registry number for 3-(2,2-Difluorocyclopropyl)-5-(trifluoromethyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,2-difluorocyclopropyl)-5-(trifluoromethyl)aniline;hydrochloride (CAS 2378503-07-0) is a chemical compound with the molecular formula C10H9ClF5N and a molecular weight of 273.63 g/mol. IUPAC name: 3-(2,2-difluorocyclopropyl)-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: FFBCFUZCQNCZDV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF5N |
|---|---|
| Molecular weight | 273.63 g/mol |
| IUPAC name | 3-(2,2-difluorocyclopropyl)-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | FFBCFUZCQNCZDV-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)C2=CC(=CC(=C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)