CAS 2378503-33-2 is the registry number for Lithium(1+) ion indolizine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium indolizine-3-carboxylate (CAS 2378503-33-2) is a chemical compound with the molecular formula C9H6LiNO2 and a molecular weight of 167.1 g/mol. IUPAC name: lithium indolizine-3-carboxylate. InChIKey: YVLSASBBAZBWSP-UHFFFAOYSA-M.
| Molecular formula | C9H6LiNO2 |
|---|---|
| Molecular weight | 167.1 g/mol |
| IUPAC name | lithium indolizine-3-carboxylate |
| InChIKey | YVLSASBBAZBWSP-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC2=CC=C(N2C=C1)C(=O)[O-] |
Computed by PubChem (NCBI)