Products 2378506-58-0

CAS 2378506-58-0 is the registry number for 6-(2,2-Dimethylthiomorpholin-4-yl)hexanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-(2,2-dimethylthiomorpholin-4-yl)hexanoic acid;hydrochloride (CAS 2378506-58-0) is a chemical compound with the molecular formula C12H24ClNO2S and a molecular weight of 281.84 g/mol. IUPAC name: 6-(2,2-dimethylthiomorpholin-4-yl)hexanoic acid;hydrochloride. InChIKey: HQGHORADZCUKPH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24ClNO2S
Molecular weight281.84 g/mol
IUPAC name6-(2,2-dimethylthiomorpholin-4-yl)hexanoic acid;hydrochloride
InChIKeyHQGHORADZCUKPH-UHFFFAOYSA-N
SMILESCC1(CN(CCS1)CCCCCC(=O)O)C.Cl

Computed by PubChem (NCBI)