CAS 2378507-10-7 is the registry number for 4,4,4-Trifluoro-3-(trifluoromethyl)butanimidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,4,4-trifluoro-3-(trifluoromethyl)butanimidamide;hydrochloride (CAS 2378507-10-7) is a chemical compound with the molecular formula C5H7ClF6N2 and a molecular weight of 244.56 g/mol. IUPAC name: 4,4,4-trifluoro-3-(trifluoromethyl)butanimidamide;hydrochloride. InChIKey: FQNQDUOAZGIURF-UHFFFAOYSA-N.
| Molecular formula | C5H7ClF6N2 |
|---|---|
| Molecular weight | 244.56 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-(trifluoromethyl)butanimidamide;hydrochloride |
| InChIKey | FQNQDUOAZGIURF-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)C(F)(F)F)C(=N)N.Cl |
Computed by PubChem (NCBI)