CAS 2378514-41-9 is the registry number for Benzyl(3,5-dibromophenyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-benzylsulfanyl-3,5-dibromobenzene (CAS 2378514-41-9) is a chemical compound with the molecular formula C13H10Br2S and a molecular weight of 358.09 g/mol. IUPAC name: 1-benzylsulfanyl-3,5-dibromobenzene. InChIKey: VZSGDTSVLOTJKG-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2S |
|---|---|
| Molecular weight | 358.09 g/mol |
| IUPAC name | 1-benzylsulfanyl-3,5-dibromobenzene |
| InChIKey | VZSGDTSVLOTJKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)