Products 2378640-67-4
CAS 2378640-67-4 is the registry number for PAN endonuclease-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-4-oxo-6-[4-(2H-tetrazol-5-yl)-2-(trifluoromethyl)phenyl]-1H-pyridine-2-carboxylic acid (CAS 2378640-67-4) is a chemical compound with the molecular formula C14H8F3N5O4 and a molecular weight of 367.24 g/mol. IUPAC name: 3-hydroxy-4-oxo-6-[4-(2H-tetrazol-5-yl)-2-(trifluoromethyl)phenyl]-1H-pyridine-2-carboxylic acid. InChIKey: CTOQHZRTEVUPLN-UHFFFAOYSA-N.
| Molecular formula | C14H8F3N5O4 |
|---|---|
| Molecular weight | 367.24 g/mol |
| IUPAC name | 3-hydroxy-4-oxo-6-[4-(2H-tetrazol-5-yl)-2-(trifluoromethyl)phenyl]-1H-pyridine-2-carboxylic acid |
| InChIKey | CTOQHZRTEVUPLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NNN=N2)C(F)(F)F)C3=CC(=O)C(=C(N3)C(=O)O)O |
Computed by PubChem (NCBI)