CAS 2378640-92-5 appears in our catalog under these names: ENPP1 Inhibitor C, Enpp-1-IN-2, 99%, Enpp1 inhibitor C, ENPP1 Inhibitor C, ≥99%, ≥99%, Enpp-1-IN-2, 99.51%. Offered by: GLPBio, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 1mg, 10mg, 50mg, 50 mg, 5 mg, 100 mg.
6-[(3-aminophenyl)methyl]-N,N,5-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CAS 2378640-92-5) is a chemical compound with the molecular formula C15H18N6 and a molecular weight of 282.34 g/mol. IUPAC name: 6-[(3-aminophenyl)methyl]-N,N,5-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine. InChIKey: VUDSCOCEYOZLJD-UHFFFAOYSA-N.
| Molecular formula | C15H18N6 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 6-[(3-aminophenyl)methyl]-N,N,5-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | VUDSCOCEYOZLJD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC=NN2C(=C1CC3=CC(=CC=C3)N)N(C)C |
Computed by PubChem (NCBI)