CAS 2378768-36-4 appears in our catalog under these names: DDO-2213, 98%, DDO-2213, 98.84%. Offered by: AmBeed, MedChemExpress. Available pack sizes: 1g, 25 mg, 100 mg, 10 mg, 50 mg, 5 mg.
4-[5-[(5-amino-6-chloropyrimidin-4-yl)amino]-2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-N,N-dimethylbenzamide (CAS 2378768-36-4) is a chemical compound with the molecular formula C24H27ClFN7O and a molecular weight of 484.0 g/mol. IUPAC name: 4-[5-[(5-amino-6-chloropyrimidin-4-yl)amino]-2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-N,N-dimethylbenzamide. InChIKey: LXONEMNSYOAQJT-UHFFFAOYSA-N.
| Molecular formula | C24H27ClFN7O |
|---|---|
| Molecular weight | 484.0 g/mol |
| IUPAC name | 4-[5-[(5-amino-6-chloropyrimidin-4-yl)amino]-2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-N,N-dimethylbenzamide |
| InChIKey | LXONEMNSYOAQJT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C(=C2)F)C3=CC=C(C=C3)C(=O)N(C)C)NC4=C(C(=NC=N4)Cl)N |
Computed by PubChem (NCBI)