Products 2378811-05-1

CAS 2378811-05-1 is the registry number for (S)-O-((Tetrahydrofuran-3-yl)methyl) ethanethioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

O-[[(3S)-oxolan-3-yl]methyl] ethanethioate (CAS 2378811-05-1) is a chemical compound with the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. IUPAC name: O-[[(3S)-oxolan-3-yl]methyl] ethanethioate. InChIKey: LDIGJHJFWTUYQZ-ZETCQYMHSA-N.

Identity
Molecular formulaC7H12O2S
Molecular weight160.24 g/mol
IUPAC nameO-[[(3S)-oxolan-3-yl]methyl] ethanethioate
InChIKeyLDIGJHJFWTUYQZ-ZETCQYMHSA-N
SMILESCC(=S)OC[C@H]1CCOC1

Computed by PubChem (NCBI)