Products 2379-79-5
CAS 2379-79-5 is the registry number for Vat Red 10. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1-amino-9,10-dioxoanthracen-2-yl)naphtho[2,3-f][1,3]benzoxazole-5,10-dione (CAS 2379-79-5) is a chemical compound with the molecular formula C29H14N2O5 and a molecular weight of 470.4 g/mol. IUPAC name: 2-(1-amino-9,10-dioxoanthracen-2-yl)naphtho[2,3-f][1,3]benzoxazole-5,10-dione. InChIKey: RHEVAQGXLUQWBM-UHFFFAOYSA-N.
| Molecular formula | C29H14N2O5 |
|---|---|
| Molecular weight | 470.4 g/mol |
| IUPAC name | 2-(1-amino-9,10-dioxoanthracen-2-yl)naphtho[2,3-f][1,3]benzoxazole-5,10-dione |
| InChIKey | RHEVAQGXLUQWBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)C4=NC5=C(O4)C=C6C(=C5)C(=O)C7=CC=CC=C7C6=O)N |
Computed by PubChem (NCBI)