CAS 23790-49-0 is the registry number for Perfluorohexanonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanenitrile (CAS 23790-49-0) is a chemical compound with the molecular formula C6F11N and a molecular weight of 295.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanenitrile. InChIKey: SIRKRRJSXWDMMJ-UHFFFAOYSA-N.
| Molecular formula | C6F11N |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanenitrile |
| InChIKey | SIRKRRJSXWDMMJ-UHFFFAOYSA-N |
| SMILES | C(#N)C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)