Products 2379241-71-9
CAS 2379241-71-9 is the registry number for 4-Bromo-1-(2-((tert-butyldimethylsilyl)oxy)ethyl)-1H-pyrazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazole-5-carbaldehyde (CAS 2379241-71-9) is a chemical compound with the molecular formula C12H21BrN2O2Si and a molecular weight of 333.30 g/mol. IUPAC name: 4-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazole-5-carbaldehyde. InChIKey: YTRRISILLKVAHJ-UHFFFAOYSA-N.
| Molecular formula | C12H21BrN2O2Si |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | 4-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrazole-5-carbaldehyde |
| InChIKey | YTRRISILLKVAHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C(=C(C=N1)Br)C=O |
Computed by PubChem (NCBI)