Products 2379241-93-5
CAS 2379241-93-5 is the registry number for 3-Bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol (CAS 2379241-93-5) is a chemical compound with the molecular formula C7H6BrF3N2O2 and a molecular weight of 287.03 g/mol. IUPAC name: 3-bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol. InChIKey: COIBLICTWCSFKD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2O2 |
|---|---|
| Molecular weight | 287.03 g/mol |
| IUPAC name | 3-bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-4-ol |
| InChIKey | COIBLICTWCSFKD-UHFFFAOYSA-N |
| SMILES | C1COC(C2=C(C(=NN21)C(F)(F)F)Br)O |
Computed by PubChem (NCBI)