CAS 2379321-31-8 appears in our catalog under these names: 1-(Benzyloxy)-4-bromo-5-chloro-2-methylbenzene, 95%, 1-(Benzyloxy)-4-bromo-5-chloro-2-methylbenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
1-bromo-2-chloro-5-methyl-4-phenylmethoxybenzene (CAS 2379321-31-8) is a chemical compound with the molecular formula C14H12BrClO and a molecular weight of 311.60 g/mol. IUPAC name: 1-bromo-2-chloro-5-methyl-4-phenylmethoxybenzene. InChIKey: ACSSQVIVKFCUBD-UHFFFAOYSA-N.
| Molecular formula | C14H12BrClO |
|---|---|
| Molecular weight | 311.60 g/mol |
| IUPAC name | 1-bromo-2-chloro-5-methyl-4-phenylmethoxybenzene |
| InChIKey | ACSSQVIVKFCUBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OCC2=CC=CC=C2)Cl)Br |
Computed by PubChem (NCBI)