CAS 2379322-22-0 appears in our catalog under these names: 1,3-Dibromo-2-(difluoromethoxy)-5-isopropylbenzene, 95%, 1,3-Dibromo-2-(difluoromethoxy)-5-isopropylbenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
1,3-dibromo-2-(difluoromethoxy)-5-propan-2-ylbenzene (CAS 2379322-22-0) is a chemical compound with the molecular formula C10H10Br2F2O and a molecular weight of 343.99 g/mol. IUPAC name: 1,3-dibromo-2-(difluoromethoxy)-5-propan-2-ylbenzene. InChIKey: CUHCBGQGPFQJJZ-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2F2O |
|---|---|
| Molecular weight | 343.99 g/mol |
| IUPAC name | 1,3-dibromo-2-(difluoromethoxy)-5-propan-2-ylbenzene |
| InChIKey | CUHCBGQGPFQJJZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)OC(F)F)Br |
Computed by PubChem (NCBI)