CAS 2379322-72-0 is the registry number for tert-Butyl 2,6-dichloro-4-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Tert-butyl 2,6-dichloro-4-(trifluoromethyl)benzoate (CAS 2379322-72-0) is a chemical compound with the molecular formula C12H11Cl2F3O2 and a molecular weight of 315.11 g/mol. IUPAC name: tert-butyl 2,6-dichloro-4-(trifluoromethyl)benzoate. InChIKey: KSGLAGCTTJLKPM-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2F3O2 |
|---|---|
| Molecular weight | 315.11 g/mol |
| IUPAC name | tert-butyl 2,6-dichloro-4-(trifluoromethyl)benzoate |
| InChIKey | KSGLAGCTTJLKPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)